C26H18Cl3N5O3S — CID 17315299
N-[[2-(3-chloro-4-methoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 17315299) has the molecular formula C26H18Cl3N5O3S and a molecular weight of 586.89 g/mol. Its IUPAC name is N-[[2-(3-chloro-4-methoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[2-(3-chloro-4-methoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17315299 |
| Molecular Formula | C26H18Cl3N5O3S |
| Molecular Weight | 586.89 g/mol |
| Exact Mass | 585.02 |
| IUPAC Name | N-[[2-(3-chloro-4-methoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | COc1ccc(-n2nc3cc(C)c(NC(=S)NC(=O)c4ccc(-c5ccc(Cl)c(Cl)c5)o4)cc3n2)cc1Cl |
| InChI | InChI=1S/C26H18Cl3N5O3S/c1-13-9-20-21(33-34(32-20)15-4-6-23(36-2)18(29)11-15)12-19(13)30-26(38)31-25(35)24-8-7-22(37-24)14-3-5-16(27)17(28)10-14/h3-12H,1-2H3,(H2,30,31,35,38) |
| InChIKey | CKNBKJUNHXEWMD-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.89 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|