C24H22ClN5O3S — CID 1334038
N-[[2-(3-chloro-4-methoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-2-(3-methylphenoxy)acetamide (PubChem CID 1334038) has the molecular formula C24H22ClN5O3S and a molecular weight of 495.99 g/mol. Its IUPAC name is N-[[2-(3-chloro-4-methoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-2-(3-methylphenoxy)acetamide.
| Compound Name | N-[[2-(3-chloro-4-methoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-2-(3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 1334038 |
| Molecular Formula | C24H22ClN5O3S |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | N-[[2-(3-chloro-4-methoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-2-(3-methylphenoxy)acetamide |
| SMILES | COc1ccc(-n2nc3cc(C)c(NC(=S)NC(=O)COc4cccc(C)c4)cc3n2)cc1Cl |
| InChI | InChI=1S/C24H22ClN5O3S/c1-14-5-4-6-17(9-14)33-13-23(31)27-24(34)26-19-12-21-20(10-15(19)2)28-30(29-21)16-7-8-22(32-3)18(25)11-16/h4-12H,13H2,1-3H3,(H2,26,27,31,34) |
| InChIKey | IQEZHIUSPJAURJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|