C26H20N6O5S — CID 5030952
N-[[2-(4-methoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 5030952) has the molecular formula C26H20N6O5S and a molecular weight of 528.55 g/mol. Its IUPAC name is N-[[2-(4-methoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[[2-(4-methoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 5030952 |
| Molecular Formula | C26H20N6O5S |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | N-[[2-(4-methoxyphenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | COc1ccc(-n2nc3cc(C)c(NC(=S)NC(=O)c4ccc(-c5cccc([N+](=O)[O-])c5)o4)cc3n2)cc1 |
| InChI | InChI=1S/C26H20N6O5S/c1-15-12-21-22(30-31(29-21)17-6-8-19(36-2)9-7-17)14-20(15)27-26(38)28-25(33)24-11-10-23(37-24)16-4-3-5-18(13-16)32(34)35/h3-14H,1-2H3,(H2,27,28,33,38) |
| InChIKey | FVHIZFTWQNVANI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|