C26H18N4O5S — CID 3407771
N-[[2-(3-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 3407771) has the molecular formula C26H18N4O5S and a molecular weight of 498.52 g/mol. Its IUPAC name is N-[[2-(3-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[[2-(3-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3407771 |
| Molecular Formula | C26H18N4O5S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | N-[[2-(3-methylphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | Cc1cccc(-c2nc3cc(NC(=S)NC(=O)c4ccc(-c5cccc([N+](=O)[O-])c5)o4)ccc3o2)c1 |
| InChI | InChI=1S/C26H18N4O5S/c1-15-4-2-6-17(12-15)25-28-20-14-18(8-9-22(20)35-25)27-26(36)29-24(31)23-11-10-21(34-23)16-5-3-7-19(13-16)30(32)33/h2-14H,1H3,(H2,27,29,31,36) |
| InChIKey | VYTSJAMAYADVDM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 123.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|