C25H15BrN4O6S — CID 5118550
N-[[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 5118550) has the molecular formula C25H15BrN4O6S and a molecular weight of 579.39 g/mol. Its IUPAC name is N-[[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 5118550 |
| Molecular Formula | C25H15BrN4O6S |
| Molecular Weight | 579.39 g/mol |
| Exact Mass | 577.99 |
| IUPAC Name | N-[[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3ccc(O)c(Br)c3)nc2c1)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C25H15BrN4O6S/c26-17-11-14(4-6-19(17)31)24-28-18-12-15(5-7-21(18)36-24)27-25(37)29-23(32)22-9-8-20(35-22)13-2-1-3-16(10-13)30(33)34/h1-12,31H,(H2,27,29,32,37) |
| InChIKey | GRDZIDLQHCGLPF-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 143.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.39 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|