C25H15ClN4O5S — CID 5019209
N-[[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 5019209) has the molecular formula C25H15ClN4O5S and a molecular weight of 518.94 g/mol. Its IUPAC name is N-[[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 5019209 |
| Molecular Formula | C25H15ClN4O5S |
| Molecular Weight | 518.94 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | N-[[3-(5-chloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc(-c2nc3cc(Cl)ccc3o2)c1)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C25H15ClN4O5S/c26-16-7-8-21-19(13-16)28-24(35-21)15-4-1-5-17(11-15)27-25(36)29-23(31)22-10-9-20(34-22)14-3-2-6-18(12-14)30(32)33/h1-13H,(H2,27,29,31,36) |
| InChIKey | SHZHZPWGADHJMC-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 123.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.94 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|