C23H14BrN3O4S — CID 5208637
N-[[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-1-benzofuran-2-carboxamide (PubChem CID 5208637) has the molecular formula C23H14BrN3O4S and a molecular weight of 508.35 g/mol. Its IUPAC name is N-[[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 5208637 |
| Molecular Formula | C23H14BrN3O4S |
| Molecular Weight | 508.35 g/mol |
| Exact Mass | 506.99 |
| IUPAC Name | N-[[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3ccc(O)c(Br)c3)nc2c1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C23H14BrN3O4S/c24-15-9-13(5-7-17(15)28)22-26-16-11-14(6-8-19(16)31-22)25-23(32)27-21(29)20-10-12-3-1-2-4-18(12)30-20/h1-11,28H,(H2,25,27,29,32) |
| InChIKey | LFFOHXPWRRVQNW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.35 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|