C25H22BrN3O4S — CID 5117113
N-[[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-butan-2-yloxybenzamide (PubChem CID 5117113) has the molecular formula C25H22BrN3O4S and a molecular weight of 540.44 g/mol. Its IUPAC name is N-[[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-butan-2-yloxybenzamide.
| Compound Name | N-[[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-butan-2-yloxybenzamide |
|---|---|
| PubChem CID | 5117113 |
| Molecular Formula | C25H22BrN3O4S |
| Molecular Weight | 540.44 g/mol |
| Exact Mass | 539.05 |
| IUPAC Name | N-[[2-(3-bromo-4-hydroxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-butan-2-yloxybenzamide |
| SMILES | CCC(C)Oc1cccc(C(=O)NC(=S)Nc2ccc3oc(-c4ccc(O)c(Br)c4)nc3c2)c1 |
| InChI | InChI=1S/C25H22BrN3O4S/c1-3-14(2)32-18-6-4-5-15(11-18)23(31)29-25(34)27-17-8-10-22-20(13-17)28-24(33-22)16-7-9-21(30)19(26)12-16/h4-14,30H,3H2,1-2H3,(H2,27,29,31,34) |
| InChIKey | OCLYGJCSRFCWQT-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.44 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|