C22H15BrFN3O3S — CID 5245089
N-[[2-(3-bromo-4-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-fluorobenzamide (PubChem CID 5245089) has the molecular formula C22H15BrFN3O3S and a molecular weight of 500.35 g/mol. Its IUPAC name is N-[[2-(3-bromo-4-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-fluorobenzamide.
| Compound Name | N-[[2-(3-bromo-4-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 5245089 |
| Molecular Formula | C22H15BrFN3O3S |
| Molecular Weight | 500.35 g/mol |
| Exact Mass | 499.00 |
| IUPAC Name | N-[[2-(3-bromo-4-methoxyphenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-3-fluorobenzamide |
| SMILES | COc1ccc(-c2nc3cc(NC(=S)NC(=O)c4cccc(F)c4)ccc3o2)cc1Br |
| InChI | InChI=1S/C22H15BrFN3O3S/c1-29-18-7-5-13(10-16(18)23)21-26-17-11-15(6-8-19(17)30-21)25-22(31)27-20(28)12-3-2-4-14(24)9-12/h2-11H,1H3,(H2,25,27,28,31) |
| InChIKey | WXXSRERHOHFJJR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.35 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|