C21H9F6N3O2S — CID 2280563
3-fluoro-N-[[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide (PubChem CID 2280563) has the molecular formula C21H9F6N3O2S and a molecular weight of 481.38 g/mol. Its IUPAC name is 3-fluoro-N-[[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide.
| Compound Name | 3-fluoro-N-[[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2280563 |
| Molecular Formula | C21H9F6N3O2S |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | 3-fluoro-N-[[2-(2,3,4,5,6-pentafluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3c(F)c(F)c(F)c(F)c3F)nc2c1)c1cccc(F)c1 |
| InChI | InChI=1S/C21H9F6N3O2S/c22-9-3-1-2-8(6-9)19(31)30-21(33)28-10-4-5-12-11(7-10)29-20(32-12)13-14(23)16(25)18(27)17(26)15(13)24/h1-7H,(H2,28,30,31,33) |
| InChIKey | OLQNSLUUVJYUQR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|