C23H13BrN4O5 — CID 17117249
N-[2-(5-bromo-3-pyridinyl)-1,3-benzoxazol-5-yl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 17117249) has the molecular formula C23H13BrN4O5 and a molecular weight of 505.28 g/mol. Its IUPAC name is N-[2-(5-bromo-3-pyridinyl)-1,3-benzoxazol-5-yl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[2-(5-bromo-3-pyridinyl)-1,3-benzoxazol-5-yl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17117249 |
| Molecular Formula | C23H13BrN4O5 |
| Molecular Weight | 505.28 g/mol |
| Exact Mass | 504.01 |
| IUPAC Name | N-[2-(5-bromo-3-pyridinyl)-1,3-benzoxazol-5-yl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2oc(-c3cncc(Br)c3)nc2c1)c1ccc(-c2cccc([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C23H13BrN4O5/c24-15-8-14(11-25-12-15)23-27-18-10-16(4-5-20(18)33-23)26-22(29)21-7-6-19(32-21)13-2-1-3-17(9-13)28(30)31/h1-12H,(H,26,29) |
| InChIKey | QLYKOFLGTVYIEQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.28 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|