C24H13BrCl2N4O3S — CID 17316691
N-[[2-(5-bromo-3-pyridinyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 17316691) has the molecular formula C24H13BrCl2N4O3S and a molecular weight of 588.27 g/mol. Its IUPAC name is N-[[2-(5-bromo-3-pyridinyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[2-(5-bromo-3-pyridinyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17316691 |
| Molecular Formula | C24H13BrCl2N4O3S |
| Molecular Weight | 588.27 g/mol |
| Exact Mass | 585.93 |
| IUPAC Name | N-[[2-(5-bromo-3-pyridinyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(3,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3cncc(Br)c3)nc2c1)c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C24H13BrCl2N4O3S/c25-14-7-13(10-28-11-14)23-30-18-9-15(2-4-20(18)34-23)29-24(35)31-22(32)21-6-5-19(33-21)12-1-3-16(26)17(27)8-12/h1-11H,(H2,29,31,32,35) |
| InChIKey | FEVSLOFYVAFVPB-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.27 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|