C25H13BrCl3N3O3S — CID 3534069
N-[[2-(5-bromo-2-chlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide (PubChem CID 3534069) has the molecular formula C25H13BrCl3N3O3S and a molecular weight of 621.73 g/mol. Its IUPAC name is N-[[2-(5-bromo-2-chlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[2-(5-bromo-2-chlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3534069 |
| Molecular Formula | C25H13BrCl3N3O3S |
| Molecular Weight | 621.73 g/mol |
| Exact Mass | 618.89 |
| IUPAC Name | N-[[2-(5-bromo-2-chlorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]-5-(2,3-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3cc(Br)ccc3Cl)nc2c1)c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C25H13BrCl3N3O3S/c26-12-4-6-16(27)15(10-12)24-31-18-11-13(5-7-20(18)35-24)30-25(36)32-23(33)21-9-8-19(34-21)14-2-1-3-17(28)22(14)29/h1-11H,(H2,30,32,33,36) |
| InChIKey | YNOAPWVACREKAE-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.73 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|