C25H15F2N3O3S — CID 5104424
5-(2-fluorophenyl)-N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]furan-2-carboxamide (PubChem CID 5104424) has the molecular formula C25H15F2N3O3S and a molecular weight of 475.48 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2-fluorophenyl)-N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 5104424 |
| Molecular Formula | C25H15F2N3O3S |
| Molecular Weight | 475.48 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | 5-(2-fluorophenyl)-N-[[2-(2-fluorophenyl)-1,3-benzoxazol-5-yl]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(-c3ccccc3F)nc2c1)c1ccc(-c2ccccc2F)o1 |
| InChI | InChI=1S/C25H15F2N3O3S/c26-17-7-3-1-5-15(17)20-11-12-22(32-20)23(31)30-25(34)28-14-9-10-21-19(13-14)29-24(33-21)16-6-2-4-8-18(16)27/h1-13H,(H2,28,30,31,34) |
| InChIKey | LATPTXJAYJNMFM-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|