C25H16Cl3N5O2S — CID 17314404
N-[[2-(4-chlorophenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 17314404) has the molecular formula C25H16Cl3N5O2S and a molecular weight of 556.86 g/mol. Its IUPAC name is N-[[2-(4-chlorophenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[2-(4-chlorophenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17314404 |
| Molecular Formula | C25H16Cl3N5O2S |
| Molecular Weight | 556.86 g/mol |
| Exact Mass | 555.01 |
| IUPAC Name | N-[[2-(4-chlorophenyl)-6-methylbenzotriazol-5-yl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | Cc1cc2nn(-c3ccc(Cl)cc3)nc2cc1NC(=S)NC(=O)c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C25H16Cl3N5O2S/c1-13-10-20-21(32-33(31-20)16-5-2-14(26)3-6-16)12-19(13)29-25(36)30-24(34)23-9-8-22(35-23)17-7-4-15(27)11-18(17)28/h2-12H,1H3,(H2,29,30,34,36) |
| InChIKey | VZAKTNPTXZHWQH-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.86 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|