C31H28Cl2N6O2S — CID 17316807
(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]prop-2-enamide (PubChem CID 17316807) has the molecular formula C31H28Cl2N6O2S and a molecular weight of 619.58 g/mol. Its IUPAC name is (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17316807 |
| Molecular Formula | C31H28Cl2N6O2S |
| Molecular Weight | 619.58 g/mol |
| Exact Mass | 618.14 |
| IUPAC Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[2-[4-(diethylamino)phenyl]-6-methylbenzotriazol-5-yl]carbamothioyl]prop-2-enamide |
| SMILES | CCN(CC)c1ccc(-n2nc3cc(C)c(NC(=S)NC(=O)/C=C/c4ccc(-c5ccc(Cl)cc5Cl)o4)cc3n2)cc1 |
| InChI | InChI=1S/C31H28Cl2N6O2S/c1-4-38(5-2)21-7-9-22(10-8-21)39-36-27-16-19(3)26(18-28(27)37-39)34-31(42)35-30(40)15-12-23-11-14-29(41-23)24-13-6-20(32)17-25(24)33/h6-18H,4-5H2,1-3H3,(H2,34,35,40,42)/b15-12+ |
| InChIKey | FXQPJWAIOSBLJN-NTCAYCPXSA-N |
| XLogP | 7.67 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.58 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|