C21H12Cl2FN3O2S2 — CID 17115063
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]prop-2-enamide (PubChem CID 17115063) has the molecular formula C21H12Cl2FN3O2S2 and a molecular weight of 492.38 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17115063 |
| Molecular Formula | C21H12Cl2FN3O2S2 |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 490.97 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(6-fluoro-1,3-benzothiazol-2-yl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)NC(=S)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C21H12Cl2FN3O2S2/c22-12-7-11(8-13(23)9-12)17-5-2-15(29-17)3-6-19(28)26-20(30)27-21-25-16-4-1-14(24)10-18(16)31-21/h1-10H,(H2,25,26,27,28,30)/b6-3+ |
| InChIKey | YCZDRHIUARLECJ-ZZXKWVIFSA-N |
| XLogP | 6.53 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|