C27H17Cl2N3O2S2 — CID 17315627
(E)-N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17315627) has the molecular formula C27H17Cl2N3O2S2 and a molecular weight of 550.49 g/mol. Its IUPAC name is (E)-N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17315627 |
| Molecular Formula | C27H17Cl2N3O2S2 |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 549.01 |
| IUPAC Name | (E)-N-[[3-(1,3-benzothiazol-2-yl)phenyl]carbamothioyl]-3-[5-(3,5-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)NC(=S)Nc1cccc(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C27H17Cl2N3O2S2/c28-18-12-17(13-19(29)15-18)23-10-8-21(34-23)9-11-25(33)32-27(35)30-20-5-3-4-16(14-20)26-31-22-6-1-2-7-24(22)36-26/h1-15H,(H2,30,32,33,35)/b11-9+ |
| InChIKey | NBCQVPKZDGBOJA-PKNBQFBNSA-N |
| XLogP | 8.06 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|