C26H17Cl2N5O2S — CID 17315674
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-phenylbenzotriazol-5-yl)carbamothioyl]prop-2-enamide (PubChem CID 17315674) has the molecular formula C26H17Cl2N5O2S and a molecular weight of 534.43 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-phenylbenzotriazol-5-yl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-phenylbenzotriazol-5-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17315674 |
| Molecular Formula | C26H17Cl2N5O2S |
| Molecular Weight | 534.43 g/mol |
| Exact Mass | 533.05 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[(2-phenylbenzotriazol-5-yl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2cc(Cl)cc(Cl)c2)o1)NC(=S)Nc1ccc2nn(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C26H17Cl2N5O2S/c27-17-12-16(13-18(28)14-17)24-10-7-21(35-24)8-11-25(34)30-26(36)29-19-6-9-22-23(15-19)32-33(31-22)20-4-2-1-3-5-20/h1-15H,(H2,29,30,34,36)/b11-8+ |
| InChIKey | JRCFEQSHAJRGSR-DHZHZOJOSA-N |
| XLogP | 6.51 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.43 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|