C28H21Cl2N5O2S — CID 17315686
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[2-(4-ethylphenyl)benzotriazol-5-yl]carbamothioyl]prop-2-enamide (PubChem CID 17315686) has the molecular formula C28H21Cl2N5O2S and a molecular weight of 562.48 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[2-(4-ethylphenyl)benzotriazol-5-yl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[2-(4-ethylphenyl)benzotriazol-5-yl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17315686 |
| Molecular Formula | C28H21Cl2N5O2S |
| Molecular Weight | 562.48 g/mol |
| Exact Mass | 561.08 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[[2-(4-ethylphenyl)benzotriazol-5-yl]carbamothioyl]prop-2-enamide |
| SMILES | CCc1ccc(-n2nc3ccc(NC(=S)NC(=O)/C=C/c4ccc(-c5cc(Cl)cc(Cl)c5)o4)cc3n2)cc1 |
| InChI | InChI=1S/C28H21Cl2N5O2S/c1-2-17-3-6-22(7-4-17)35-33-24-10-5-21(16-25(24)34-35)31-28(38)32-27(36)12-9-23-8-11-26(37-23)18-13-19(29)15-20(30)14-18/h3-16H,2H2,1H3,(H2,31,32,36,38)/b12-9+ |
| InChIKey | KBXPKECKIHSRAW-FMIVXFBMSA-N |
| XLogP | 7.08 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.48 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|