C30H26ClN5O2S — CID 5236999
N-[[2-(4-butylphenyl)benzotriazol-5-yl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 5236999) has the molecular formula C30H26ClN5O2S and a molecular weight of 556.09 g/mol. Its IUPAC name is N-[[2-(4-butylphenyl)benzotriazol-5-yl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[[2-(4-butylphenyl)benzotriazol-5-yl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 5236999 |
| Molecular Formula | C30H26ClN5O2S |
| Molecular Weight | 556.09 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | N-[[2-(4-butylphenyl)benzotriazol-5-yl]carbamothioyl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | CCCCc1ccc(-n2nc3ccc(NC(=S)NC(=O)C=Cc4ccc(-c5ccc(Cl)cc5)o4)cc3n2)cc1 |
| InChI | InChI=1S/C30H26ClN5O2S/c1-2-3-4-20-5-12-24(13-6-20)36-34-26-16-11-23(19-27(26)35-36)32-30(39)33-29(37)18-15-25-14-17-28(38-25)21-7-9-22(31)10-8-21/h5-19H,2-4H2,1H3,(H2,32,33,37,39) |
| InChIKey | RJJDJVFVQLPUSG-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.09 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|