C26H21Cl2N5OS2 — CID 4667055
N-[[2-(4-butylphenyl)benzotriazol-5-yl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 4667055) has the molecular formula C26H21Cl2N5OS2 and a molecular weight of 554.53 g/mol. Its IUPAC name is N-[[2-(4-butylphenyl)benzotriazol-5-yl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[2-(4-butylphenyl)benzotriazol-5-yl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4667055 |
| Molecular Formula | C26H21Cl2N5OS2 |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 553.06 |
| IUPAC Name | N-[[2-(4-butylphenyl)benzotriazol-5-yl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | CCCCc1ccc(-n2nc3ccc(NC(=S)NC(=O)c4sc5cc(Cl)ccc5c4Cl)cc3n2)cc1 |
| InChI | InChI=1S/C26H21Cl2N5OS2/c1-2-3-4-15-5-9-18(10-6-15)33-31-20-12-8-17(14-21(20)32-33)29-26(35)30-25(34)24-23(28)19-11-7-16(27)13-22(19)36-24/h5-14H,2-4H2,1H3,(H2,29,30,34,35) |
| InChIKey | UYEWWKXTFIAYMK-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|