C26H19Cl2N3O2S2 — CID 54859766
3,6-dichloro-N-[[4-[(5-ethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 54859766) has the molecular formula C26H19Cl2N3O2S2 and a molecular weight of 540.50 g/mol. Its IUPAC name is 3,6-dichloro-N-[[4-[(5-ethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[[4-[(5-ethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 54859766 |
| Molecular Formula | C26H19Cl2N3O2S2 |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 539.03 |
| IUPAC Name | 3,6-dichloro-N-[[4-[(5-ethyl-1,3-benzoxazol-2-yl)methyl]phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | CCc1ccc2oc(Cc3ccc(NC(=S)NC(=O)c4sc5cc(Cl)ccc5c4Cl)cc3)nc2c1 |
| InChI | InChI=1S/C26H19Cl2N3O2S2/c1-2-14-5-10-20-19(11-14)30-22(33-20)12-15-3-7-17(8-4-15)29-26(34)31-25(32)24-23(28)18-9-6-16(27)13-21(18)35-24/h3-11,13H,2,12H2,1H3,(H2,29,31,32,34) |
| InChIKey | ITHZVNSJYJDQMB-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.50 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|