C24H15Cl2N3O3S2 — CID 4239698
3,6-dichloro-N-[[3-hydroxy-4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 4239698) has the molecular formula C24H15Cl2N3O3S2 and a molecular weight of 528.44 g/mol. Its IUPAC name is 3,6-dichloro-N-[[3-hydroxy-4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[[3-hydroxy-4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 4239698 |
| Molecular Formula | C24H15Cl2N3O3S2 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 526.99 |
| IUPAC Name | 3,6-dichloro-N-[[3-hydroxy-4-(5-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2oc(-c3ccc(NC(=S)NC(=O)c4sc5cc(Cl)ccc5c4Cl)cc3O)nc2c1 |
| InChI | InChI=1S/C24H15Cl2N3O3S2/c1-11-2-7-18-16(8-11)28-23(32-18)14-6-4-13(10-17(14)30)27-24(33)29-22(31)21-20(26)15-5-3-12(25)9-19(15)34-21/h2-10,30H,1H3,(H2,27,29,31,33) |
| InChIKey | LRCHJHDXIMCCEF-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|