C26H17BrClN3O4S — CID 137066906
4-bromo-N-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide (PubChem CID 137066906) has the molecular formula C26H17BrClN3O4S and a molecular weight of 582.86 g/mol. Its IUPAC name is 4-bromo-N-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | 4-bromo-N-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 137066906 |
| Molecular Formula | C26H17BrClN3O4S |
| Molecular Weight | 582.86 g/mol |
| Exact Mass | 580.98 |
| IUPAC Name | 4-bromo-N-[[4-(5-chloro-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1c(C(=O)NC(=S)Nc2ccc(-c3nc4cc(Cl)ccc4o3)c(O)c2)cc2ccccc2c1Br |
| InChI | InChI=1S/C26H17BrClN3O4S/c1-34-23-18(10-13-4-2-3-5-16(13)22(23)27)24(33)31-26(36)29-15-7-8-17(20(32)12-15)25-30-19-11-14(28)6-9-21(19)35-25/h2-12,32H,1H3,(H2,29,31,33,36) |
| InChIKey | WRWIMLSSWRWSDN-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.86 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|