C27H21N3O3S — CID 135718020
N-[[4-(5-ethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]naphthalene-1-carboxamide (PubChem CID 135718020) has the molecular formula C27H21N3O3S and a molecular weight of 467.55 g/mol. Its IUPAC name is N-[[4-(5-ethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]naphthalene-1-carboxamide.
| Compound Name | N-[[4-(5-ethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 135718020 |
| Molecular Formula | C27H21N3O3S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | N-[[4-(5-ethyl-1,3-benzoxazol-2-yl)-3-hydroxyphenyl]carbamothioyl]naphthalene-1-carboxamide |
| SMILES | CCc1ccc2oc(-c3ccc(NC(=S)NC(=O)c4cccc5ccccc45)cc3O)nc2c1 |
| InChI | InChI=1S/C27H21N3O3S/c1-2-16-10-13-24-22(14-16)29-26(33-24)21-12-11-18(15-23(21)31)28-27(34)30-25(32)20-9-5-7-17-6-3-4-8-19(17)20/h3-15,31H,2H2,1H3,(H2,28,30,32,34) |
| InChIKey | KXGVKFCBCHHLLA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|