C26H16BrCl2N3O3S — CID 17315369
4-bromo-N-[[3-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide (PubChem CID 17315369) has the molecular formula C26H16BrCl2N3O3S and a molecular weight of 601.31 g/mol. Its IUPAC name is 4-bromo-N-[[3-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | 4-bromo-N-[[3-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 17315369 |
| Molecular Formula | C26H16BrCl2N3O3S |
| Molecular Weight | 601.31 g/mol |
| Exact Mass | 598.95 |
| IUPAC Name | 4-bromo-N-[[3-(5,7-dichloro-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1c(C(=O)NC(=S)Nc2cccc(-c3nc4cc(Cl)cc(Cl)c4o3)c2)cc2ccccc2c1Br |
| InChI | InChI=1S/C26H16BrCl2N3O3S/c1-34-22-18(10-13-5-2-3-8-17(13)21(22)27)24(33)32-26(36)30-16-7-4-6-14(9-16)25-31-20-12-15(28)11-19(29)23(20)35-25/h2-12H,1H3,(H2,30,32,33,36) |
| InChIKey | RNAPVFAOVWRGPT-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.31 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|