C24H14Cl3N3O2S2 — CID 17316394
3,6-dichloro-N-[[2-chloro-5-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 17316394) has the molecular formula C24H14Cl3N3O2S2 and a molecular weight of 546.89 g/mol. Its IUPAC name is 3,6-dichloro-N-[[2-chloro-5-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[[2-chloro-5-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17316394 |
| Molecular Formula | C24H14Cl3N3O2S2 |
| Molecular Weight | 546.89 g/mol |
| Exact Mass | 544.96 |
| IUPAC Name | 3,6-dichloro-N-[[2-chloro-5-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2nc(-c3ccc(Cl)c(NC(=S)NC(=O)c4sc5cc(Cl)ccc5c4Cl)c3)oc2c1 |
| InChI | InChI=1S/C24H14Cl3N3O2S2/c1-11-2-7-16-18(8-11)32-23(28-16)12-3-6-15(26)17(9-12)29-24(33)30-22(31)21-20(27)14-5-4-13(25)10-19(14)34-21/h2-10H,1H3,(H2,29,30,31,33) |
| InChIKey | YIIGGUPWJDUSOT-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.89 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|