C27H28ClN3O2S — CID 3996766
2-(1-adamantyl)-N-[[2-chloro-5-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]acetamide (PubChem CID 3996766) has the molecular formula C27H28ClN3O2S and a molecular weight of 494.06 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[[2-chloro-5-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[[2-chloro-5-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3996766 |
| Molecular Formula | C27H28ClN3O2S |
| Molecular Weight | 494.06 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | 2-(1-adamantyl)-N-[[2-chloro-5-(6-methyl-1,3-benzoxazol-2-yl)phenyl]carbamothioyl]acetamide |
| SMILES | Cc1ccc2nc(-c3ccc(Cl)c(NC(=S)NC(=O)CC45CC6CC(CC(C6)C4)C5)c3)oc2c1 |
| InChI | InChI=1S/C27H28ClN3O2S/c1-15-2-5-21-23(6-15)33-25(29-21)19-3-4-20(28)22(10-19)30-26(34)31-24(32)14-27-11-16-7-17(12-27)9-18(8-16)13-27/h2-6,10,16-18H,7-9,11-14H2,1H3,(H2,30,31,32,34) |
| InChIKey | PFLBHYKENASAGG-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.06 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|