C27H30N2O2 — CID 3983902
2-(1-adamantyl)-N-[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]acetamide (PubChem CID 3983902) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]acetamide |
|---|---|
| PubChem CID | 3983902 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]acetamide |
| SMILES | Cc1cc(C)cc(-c2nc3cc(NC(=O)CC45CC6CC(CC(C6)C4)C5)ccc3o2)c1 |
| InChI | InChI=1S/C27H30N2O2/c1-16-5-17(2)7-21(6-16)26-29-23-11-22(3-4-24(23)31-26)28-25(30)15-27-12-18-8-19(13-27)10-20(9-18)14-27/h3-7,11,18-20H,8-10,12-15H2,1-2H3,(H,28,30) |
| InChIKey | PFTZHZZVKACPIT-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |