C29H34N2O2 — CID 3610006
2-(1-adamantyl)-N-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]acetamide (PubChem CID 3610006) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 3610006 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 2-(1-adamantyl)-N-[4-(5-butan-2-yl-1,3-benzoxazol-2-yl)phenyl]acetamide |
| SMILES | CCC(C)c1ccc2oc(-c3ccc(NC(=O)CC45CC6CC(CC(C6)C4)C5)cc3)nc2c1 |
| InChI | InChI=1S/C29H34N2O2/c1-3-18(2)23-6-9-26-25(13-23)31-28(33-26)22-4-7-24(8-5-22)30-27(32)17-29-14-19-10-20(15-29)12-21(11-19)16-29/h4-9,13,18-21H,3,10-12,14-17H2,1-2H3,(H,30,32) |
| InChIKey | PSRRFRCMJVQEIR-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |