C23H19N3O5 — CID 1256188
N-[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]-2-(2-nitrophenoxy)acetamide (PubChem CID 1256188) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]-2-(2-nitrophenoxy)acetamide.
| Compound Name | N-[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]-2-(2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 1256188 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-[2-(3,5-dimethylphenyl)-1,3-benzoxazol-5-yl]-2-(2-nitrophenoxy)acetamide |
| SMILES | Cc1cc(C)cc(-c2nc3cc(NC(=O)COc4ccccc4[N+](=O)[O-])ccc3o2)c1 |
| InChI | InChI=1S/C23H19N3O5/c1-14-9-15(2)11-16(10-14)23-25-18-12-17(7-8-20(18)31-23)24-22(27)13-30-21-6-4-3-5-19(21)26(28)29/h3-12H,13H2,1-2H3,(H,24,27) |
| InChIKey | VWAFLBRIBCQNJA-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|