C26H20Cl3N5OS2 — CID 17316975
N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide (PubChem CID 17316975) has the molecular formula C26H20Cl3N5OS2 and a molecular weight of 588.97 g/mol. Its IUPAC name is N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 17316975 |
| Molecular Formula | C26H20Cl3N5OS2 |
| Molecular Weight | 588.97 g/mol |
| Exact Mass | 587.02 |
| IUPAC Name | N-[[2-(4-butylphenyl)-6-chlorobenzotriazol-5-yl]carbamothioyl]-3,6-dichloro-1-benzothiophene-2-carboxamide |
| SMILES | CCCCc1ccc(-n2nc3cc(Cl)c(NC(=S)NC(=O)c4sc5cc(Cl)ccc5c4Cl)cc3n2)cc1 |
| InChI | InChI=1S/C26H20Cl3N5OS2/c1-2-3-4-14-5-8-16(9-6-14)34-32-20-12-18(28)19(13-21(20)33-34)30-26(36)31-25(35)24-23(29)17-10-7-15(27)11-22(17)37-24/h5-13H,2-4H2,1H3,(H2,30,31,35,36) |
| InChIKey | UHSRGOVINTUWBK-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.97 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|