C25H16BrClN4O2 — CID 4163675
N-[2-(4-bromophenyl)benzotriazol-5-yl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 4163675) has the molecular formula C25H16BrClN4O2 and a molecular weight of 519.79 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)benzotriazol-5-yl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[2-(4-bromophenyl)benzotriazol-5-yl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4163675 |
| Molecular Formula | C25H16BrClN4O2 |
| Molecular Weight | 519.79 g/mol |
| Exact Mass | 518.01 |
| IUPAC Name | N-[2-(4-bromophenyl)benzotriazol-5-yl]-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2ccc(Cl)cc2)o1)Nc1ccc2nn(-c3ccc(Br)cc3)nc2c1 |
| InChI | InChI=1S/C25H16BrClN4O2/c26-17-3-8-20(9-4-17)31-29-22-12-7-19(15-23(22)30-31)28-25(32)14-11-21-10-13-24(33-21)16-1-5-18(27)6-2-16/h1-15H,(H,28,32) |
| InChIKey | RUJBFIRRKSLXDC-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.79 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|