C16H12BrN5O2 — CID 17162738
(E)-3-[5-(4-bromophenyl)furan-2-yl]-N-(2-ethenyltetrazol-5-yl)prop-2-enamide (PubChem CID 17162738) has the molecular formula C16H12BrN5O2 and a molecular weight of 386.21 g/mol. Its IUPAC name is (E)-3-[5-(4-bromophenyl)furan-2-yl]-N-(2-ethenyltetrazol-5-yl)prop-2-enamide.
| Compound Name | (E)-3-[5-(4-bromophenyl)furan-2-yl]-N-(2-ethenyltetrazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 17162738 |
| Molecular Formula | C16H12BrN5O2 |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | (E)-3-[5-(4-bromophenyl)furan-2-yl]-N-(2-ethenyltetrazol-5-yl)prop-2-enamide |
| SMILES | C=Cn1nnc(NC(=O)/C=C/c2ccc(-c3ccc(Br)cc3)o2)n1 |
| InChI | InChI=1S/C16H12BrN5O2/c1-2-22-20-16(19-21-22)18-15(23)10-8-13-7-9-14(24-13)11-3-5-12(17)6-4-11/h2-10H,1H2,(H,18,20,23)/b10-8+ |
| InChIKey | QKZQSQUQQUBCPF-CSKARUKUSA-N |
| XLogP | 3.45 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|