C19H13BrO3 — CID 1352039
(1E)-1-[5-(4-bromophenyl)furan-2-yl]-5-(furan-2-yl)penta-1,4-dien-3-one (PubChem CID 1352039) has the molecular formula C19H13BrO3 and a molecular weight of 369.21 g/mol. Its IUPAC name is (1E)-1-[5-(4-bromophenyl)furan-2-yl]-5-(furan-2-yl)penta-1,4-dien-3-one.
| Compound Name | (1E)-1-[5-(4-bromophenyl)furan-2-yl]-5-(furan-2-yl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 1352039 |
| Molecular Formula | C19H13BrO3 |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | (1E)-1-[5-(4-bromophenyl)furan-2-yl]-5-(furan-2-yl)penta-1,4-dien-3-one |
| SMILES | O=C(C=Cc1ccco1)/C=C/c1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C19H13BrO3/c20-15-5-3-14(4-6-15)19-12-11-18(23-19)10-8-16(21)7-9-17-2-1-13-22-17/h1-13H/b9-7?,10-8+ |
| InChIKey | CVEHDJSOKNCPOW-LSVQJBSPSA-N |
| XLogP | 5.60 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|