C15H12O2 — CID 92904073
(1E,4Z)-1-(furan-2-yl)-5-phenylpenta-1,4-dien-3-one (PubChem CID 92904073) has the molecular formula C15H12O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is (1E,4Z)-1-(furan-2-yl)-5-phenylpenta-1,4-dien-3-one.
| Compound Name | (1E,4Z)-1-(furan-2-yl)-5-phenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 92904073 |
| Molecular Formula | C15H12O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | (1E,4Z)-1-(furan-2-yl)-5-phenylpenta-1,4-dien-3-one |
| SMILES | O=C(/C=C\c1ccccc1)/C=C/c1ccco1 |
| InChI | InChI=1S/C15H12O2/c16-14(10-11-15-7-4-12-17-15)9-8-13-5-2-1-3-6-13/h1-12H/b9-8-,11-10+ |
| InChIKey | RJNMUTDRDATJLP-QNRZBPGKSA-N |
| XLogP | 3.58 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|