C24H22BrNO6S — CID 4697682
diethyl 5-[3-[5-(4-bromophenyl)furan-2-yl]prop-2-enoylamino]-3-methylthiophene-2,4-dicarboxylate (PubChem CID 4697682) has the molecular formula C24H22BrNO6S and a molecular weight of 532.41 g/mol. Its IUPAC name is diethyl 5-[3-[5-(4-bromophenyl)furan-2-yl]prop-2-enoylamino]-3-methylthiophene-2,4-dicarboxylate.
| Compound Name | diethyl 5-[3-[5-(4-bromophenyl)furan-2-yl]prop-2-enoylamino]-3-methylthiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 4697682 |
| Molecular Formula | C24H22BrNO6S |
| Molecular Weight | 532.41 g/mol |
| Exact Mass | 531.04 |
| IUPAC Name | diethyl 5-[3-[5-(4-bromophenyl)furan-2-yl]prop-2-enoylamino]-3-methylthiophene-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1sc(NC(=O)C=Cc2ccc(-c3ccc(Br)cc3)o2)c(C(=O)OCC)c1C |
| InChI | InChI=1S/C24H22BrNO6S/c1-4-30-23(28)20-14(3)21(24(29)31-5-2)33-22(20)26-19(27)13-11-17-10-12-18(32-17)15-6-8-16(25)9-7-15/h6-13H,4-5H2,1-3H3,(H,26,27) |
| InChIKey | OAHHLALRAZEDBB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.41 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|