C17H17NO6S — CID 4117913
dimethyl 3-methyl-5-[3-(5-methylfuran-2-yl)prop-2-enoylamino]thiophene-2,4-dicarboxylate (PubChem CID 4117913) has the molecular formula C17H17NO6S and a molecular weight of 363.39 g/mol. Its IUPAC name is dimethyl 3-methyl-5-[3-(5-methylfuran-2-yl)prop-2-enoylamino]thiophene-2,4-dicarboxylate.
| Compound Name | dimethyl 3-methyl-5-[3-(5-methylfuran-2-yl)prop-2-enoylamino]thiophene-2,4-dicarboxylate |
|---|---|
| PubChem CID | 4117913 |
| Molecular Formula | C17H17NO6S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | dimethyl 3-methyl-5-[3-(5-methylfuran-2-yl)prop-2-enoylamino]thiophene-2,4-dicarboxylate |
| SMILES | COC(=O)c1sc(NC(=O)C=Cc2ccc(C)o2)c(C(=O)OC)c1C |
| InChI | InChI=1S/C17H17NO6S/c1-9-5-6-11(24-9)7-8-12(19)18-15-13(16(20)22-3)10(2)14(25-15)17(21)23-4/h5-8H,1-4H3,(H,18,19) |
| InChIKey | LXKIJWHLTKKWQA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|