C17H16N2O4S — CID 44918669
methyl 4-carbamoyl-3-methyl-5-[[(E)-3-phenylprop-2-enoyl]amino]thiophene-2-carboxylate (PubChem CID 44918669) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is methyl 4-carbamoyl-3-methyl-5-[[(E)-3-phenylprop-2-enoyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 4-carbamoyl-3-methyl-5-[[(E)-3-phenylprop-2-enoyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 44918669 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | methyl 4-carbamoyl-3-methyl-5-[[(E)-3-phenylprop-2-enoyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc(NC(=O)/C=C/c2ccccc2)c(C(N)=O)c1C |
| InChI | InChI=1S/C17H16N2O4S/c1-10-13(15(18)21)16(24-14(10)17(22)23-2)19-12(20)9-8-11-6-4-3-5-7-11/h3-9H,1-2H3,(H2,18,21)(H,19,20)/b9-8+ |
| InChIKey | YOEDJGJPATXYFV-CMDGGOBGSA-N |
| XLogP | 2.59 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|