C17H15NO6S — CID 22300103
5-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylic acid (PubChem CID 22300103) has the molecular formula C17H15NO6S and a molecular weight of 361.38 g/mol. Its IUPAC name is 5-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylic acid.
| Compound Name | 5-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 22300103 |
| Molecular Formula | C17H15NO6S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 5-[[(E)-3-(4-methoxyphenyl)prop-2-enoyl]amino]-3-methylthiophene-2,4-dicarboxylic acid |
| SMILES | COc1ccc(/C=C/C(=O)Nc2sc(C(=O)O)c(C)c2C(=O)O)cc1 |
| InChI | InChI=1S/C17H15NO6S/c1-9-13(16(20)21)15(25-14(9)17(22)23)18-12(19)8-5-10-3-6-11(24-2)7-4-10/h3-8H,1-2H3,(H,18,19)(H,20,21)(H,22,23)/b8-5+ |
| InChIKey | ATFSKBVCGXMMDP-VMPITWQZSA-N |
| XLogP | 3.11 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|