C20H23NO4S — CID 5092745
ethyl 4-ethyl-2-[3-(4-methoxyphenyl)prop-2-enoylamino]-5-methylthiophene-3-carboxylate (PubChem CID 5092745) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is ethyl 4-ethyl-2-[3-(4-methoxyphenyl)prop-2-enoylamino]-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 4-ethyl-2-[3-(4-methoxyphenyl)prop-2-enoylamino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 5092745 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | ethyl 4-ethyl-2-[3-(4-methoxyphenyl)prop-2-enoylamino]-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C=Cc2ccc(OC)cc2)sc(C)c1CC |
| InChI | InChI=1S/C20H23NO4S/c1-5-16-13(3)26-19(18(16)20(23)25-6-2)21-17(22)12-9-14-7-10-15(24-4)11-8-14/h7-12H,5-6H2,1-4H3,(H,21,22) |
| InChIKey | GQCOFRFWUUMBKD-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|