C26H17Cl3N4O2 — CID 4555337
N-[2-(3-chloro-4-methylphenyl)benzotriazol-5-yl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 4555337) has the molecular formula C26H17Cl3N4O2 and a molecular weight of 523.81 g/mol. Its IUPAC name is N-[2-(3-chloro-4-methylphenyl)benzotriazol-5-yl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[2-(3-chloro-4-methylphenyl)benzotriazol-5-yl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4555337 |
| Molecular Formula | C26H17Cl3N4O2 |
| Molecular Weight | 523.81 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | N-[2-(3-chloro-4-methylphenyl)benzotriazol-5-yl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | Cc1ccc(-n2nc3ccc(NC(=O)C=Cc4ccc(-c5cccc(Cl)c5Cl)o4)cc3n2)cc1Cl |
| InChI | InChI=1S/C26H17Cl3N4O2/c1-15-5-7-17(14-21(15)28)33-31-22-10-6-16(13-23(22)32-33)30-25(34)12-9-18-8-11-24(35-18)19-3-2-4-20(27)26(19)29/h2-14H,1H3,(H,30,34) |
| InChIKey | REQSMNLXTWBATF-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.81 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|