C24H23Cl2N3O4S — CID 17319511
(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]prop-2-enamide (PubChem CID 17319511) has the molecular formula C24H23Cl2N3O4S and a molecular weight of 520.44 g/mol. Its IUPAC name is (E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17319511 |
| Molecular Formula | C24H23Cl2N3O4S |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | (E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[4-(4-methylsulfonylpiperazin-1-yl)phenyl]prop-2-enamide |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(NC(=O)/C=C/c3ccc(-c4cccc(Cl)c4Cl)o3)cc2)CC1 |
| InChI | InChI=1S/C24H23Cl2N3O4S/c1-34(31,32)29-15-13-28(14-16-29)18-7-5-17(6-8-18)27-23(30)12-10-19-9-11-22(33-19)20-3-2-4-21(25)24(20)26/h2-12H,13-16H2,1H3,(H,27,30)/b12-10+ |
| InChIKey | QSIZYXBDVGVUKX-ZRDIBKRKSA-N |
| XLogP | 4.99 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|