C24H19Cl2N3O3S — CID 3987720
3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)prop-2-enamide (PubChem CID 3987720) has the molecular formula C24H19Cl2N3O3S and a molecular weight of 500.41 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)prop-2-enamide.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 3987720 |
| Molecular Formula | C24H19Cl2N3O3S |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 499.05 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)Nc1nc2ccc(N3CCOCC3)cc2s1 |
| InChI | InChI=1S/C24H19Cl2N3O3S/c25-18-3-1-2-17(23(18)26)20-8-5-16(32-20)6-9-22(30)28-24-27-19-7-4-15(14-21(19)33-24)29-10-12-31-13-11-29/h1-9,14H,10-13H2,(H,27,28,30) |
| InChIKey | VKDJBAKYIGEQRI-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|