C26H15Cl3N2O2S — CID 4675727
N-[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 4675727) has the molecular formula C26H15Cl3N2O2S and a molecular weight of 525.84 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4675727 |
| Molecular Formula | C26H15Cl3N2O2S |
| Molecular Weight | 525.84 g/mol |
| Exact Mass | 523.99 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)-4-chlorophenyl]-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)Nc1ccc(Cl)c(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C26H15Cl3N2O2S/c27-19-11-8-15(14-18(19)26-31-21-6-1-2-7-23(21)34-26)30-24(32)13-10-16-9-12-22(33-16)17-4-3-5-20(28)25(17)29/h1-14H,(H,30,32) |
| InChIKey | LXOLDQHAGZLCHF-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.84 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|