C28H18Cl2N2O4 — CID 17319117
N-[4-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 17319117) has the molecular formula C28H18Cl2N2O4 and a molecular weight of 517.37 g/mol. Its IUPAC name is N-[4-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17319117 |
| Molecular Formula | C28H18Cl2N2O4 |
| Molecular Weight | 517.37 g/mol |
| Exact Mass | 516.06 |
| IUPAC Name | N-[4-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(/C=C/c1ccc(-c2cccc(Cl)c2Cl)o1)Nc1ccc(NC(=O)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C28H18Cl2N2O4/c29-22-6-3-5-21(27(22)30)24-14-12-20(35-24)13-15-26(33)31-18-8-10-19(11-9-18)32-28(34)25-16-17-4-1-2-7-23(17)36-25/h1-16H,(H,31,33)(H,32,34)/b15-13+ |
| InChIKey | QHLKITOBDXPLTD-FYWRMAATSA-N |
| XLogP | 7.90 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.37 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|