C29H21ClN2O4 — CID 17117642
N-[4-[[(E)-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enoyl]amino]-2-methylphenyl]-1-benzofuran-2-carboxamide (PubChem CID 17117642) has the molecular formula C29H21ClN2O4 and a molecular weight of 496.95 g/mol. Its IUPAC name is N-[4-[[(E)-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enoyl]amino]-2-methylphenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[[(E)-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enoyl]amino]-2-methylphenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17117642 |
| Molecular Formula | C29H21ClN2O4 |
| Molecular Weight | 496.95 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | N-[4-[[(E)-3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enoyl]amino]-2-methylphenyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2ccc(-c3ccc(Cl)cc3)o2)ccc1NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C29H21ClN2O4/c1-18-16-22(10-13-24(18)32-29(34)27-17-20-4-2-3-5-25(20)36-27)31-28(33)15-12-23-11-14-26(35-23)19-6-8-21(30)9-7-19/h2-17H,1H3,(H,31,33)(H,32,34)/b15-12+ |
| InChIKey | MNNVJXZNEIELSV-NTCAYCPXSA-N |
| XLogP | 7.56 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.95 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|