C27H20Cl2N2O4 — CID 4234240
2-chloro-N-[4-[3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enoylamino]-2-methoxyphenyl]benzamide (PubChem CID 4234240) has the molecular formula C27H20Cl2N2O4 and a molecular weight of 507.37 g/mol. Its IUPAC name is 2-chloro-N-[4-[3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enoylamino]-2-methoxyphenyl]benzamide.
| Compound Name | 2-chloro-N-[4-[3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enoylamino]-2-methoxyphenyl]benzamide |
|---|---|
| PubChem CID | 4234240 |
| Molecular Formula | C27H20Cl2N2O4 |
| Molecular Weight | 507.37 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 2-chloro-N-[4-[3-[5-(4-chlorophenyl)furan-2-yl]prop-2-enoylamino]-2-methoxyphenyl]benzamide |
| SMILES | COc1cc(NC(=O)C=Cc2ccc(-c3ccc(Cl)cc3)o2)ccc1NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C27H20Cl2N2O4/c1-34-25-16-19(10-13-23(25)31-27(33)21-4-2-3-5-22(21)29)30-26(32)15-12-20-11-14-24(35-20)17-6-8-18(28)9-7-17/h2-16H,1H3,(H,30,32)(H,31,33) |
| InChIKey | QOUOQSOSZLLRNW-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.37 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|