C22H16N4O5S — CID 17335895
(E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17335895) has the molecular formula C22H16N4O5S and a molecular weight of 448.46 g/mol. Its IUPAC name is (E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17335895 |
| Molecular Formula | C22H16N4O5S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | (E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-[5-(2-nitrophenyl)furan-2-yl]prop-2-enamide |
| SMILES | CC(=O)Nc1ccc2nc(NC(=O)/C=C/c3ccc(-c4ccccc4[N+](=O)[O-])o3)sc2c1 |
| InChI | InChI=1S/C22H16N4O5S/c1-13(27)23-14-6-9-17-20(12-14)32-22(24-17)25-21(28)11-8-15-7-10-19(31-15)16-4-2-3-5-18(16)26(29)30/h2-12H,1H3,(H,23,27)(H,24,25,28)/b11-8+ |
| InChIKey | PNDKGUQBNGYWIZ-DHZHZOJOSA-N |
| XLogP | 5.07 |
| TPSA | 127.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|